C20H13BrF2N2O4S — CID 143954380
4-(4-bromo-2,3-difluorophenyl)-2-(7,8-dihydro-6H-cyclohepta[d][1,3]oxazole-2-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 143954380) has the molecular formula C20H13BrF2N2O4S and a molecular weight of 495.30 g/mol. Its IUPAC name is 4-(4-bromo-2,3-difluorophenyl)-2-(7,8-dihydro-6H-cyclohepta[d][1,3]oxazole-2-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(4-bromo-2,3-difluorophenyl)-2-(7,8-dihydro-6H-cyclohepta[d][1,3]oxazole-2-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 143954380 |
| Molecular Formula | C20H13BrF2N2O4S |
| Molecular Weight | 495.30 g/mol |
| Exact Mass | 493.97 |
| IUPAC Name | 4-(4-bromo-2,3-difluorophenyl)-2-(7,8-dihydro-6H-cyclohepta[d][1,3]oxazole-2-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccc(Br)c(F)c2F)c1C(=O)O)c1nc2c(o1)CCCC=C2 |
| InChI | InChI=1S/C20H13BrF2N2O4S/c21-11-7-6-9(15(22)16(11)23)10-8-30-19(14(10)20(27)28)25-17(26)18-24-12-4-2-1-3-5-13(12)29-18/h2,4,6-8H,1,3,5H2,(H,25,26)(H,27,28) |
| InChIKey | JSUWZBQZCDITPM-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.30 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|