C20H16F2N2O3S — CID 89458011
4-(2,3-difluoro-4-methylphenyl)-2-[[2-(methylamino)benzoyl]amino]thiophene-3-carboxylic acid (PubChem CID 89458011) has the molecular formula C20H16F2N2O3S and a molecular weight of 402.42 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-methylphenyl)-2-[[2-(methylamino)benzoyl]amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(2,3-difluoro-4-methylphenyl)-2-[[2-(methylamino)benzoyl]amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89458011 |
| Molecular Formula | C20H16F2N2O3S |
| Molecular Weight | 402.42 g/mol |
| Exact Mass | 402.08 |
| IUPAC Name | 4-(2,3-difluoro-4-methylphenyl)-2-[[2-(methylamino)benzoyl]amino]thiophene-3-carboxylic acid |
| SMILES | CNc1ccccc1C(=O)Nc1scc(-c2ccc(C)c(F)c2F)c1C(=O)O |
| InChI | InChI=1S/C20H16F2N2O3S/c1-10-7-8-11(17(22)16(10)21)13-9-28-19(15(13)20(26)27)24-18(25)12-5-3-4-6-14(12)23-2/h3-9,23H,1-2H3,(H,24,25)(H,26,27) |
| InChIKey | DMVXHZGTTPDARH-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.42 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|