C23H17F2NO4S — CID 123225433
N-[4-(2,3-difluoro-4-methylphenyl)-3-(dihydroxymethyl)thiophen-2-yl]-2-hydroxynaphthalene-1-carboxamide (PubChem CID 123225433) has the molecular formula C23H17F2NO4S and a molecular weight of 441.46 g/mol. Its IUPAC name is N-[4-(2,3-difluoro-4-methylphenyl)-3-(dihydroxymethyl)thiophen-2-yl]-2-hydroxynaphthalene-1-carboxamide.
| Compound Name | N-[4-(2,3-difluoro-4-methylphenyl)-3-(dihydroxymethyl)thiophen-2-yl]-2-hydroxynaphthalene-1-carboxamide |
|---|---|
| PubChem CID | 123225433 |
| Molecular Formula | C23H17F2NO4S |
| Molecular Weight | 441.46 g/mol |
| Exact Mass | 441.08 |
| IUPAC Name | N-[4-(2,3-difluoro-4-methylphenyl)-3-(dihydroxymethyl)thiophen-2-yl]-2-hydroxynaphthalene-1-carboxamide |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3c(O)ccc4ccccc34)c2C(O)O)c(F)c1F |
| InChI | InChI=1S/C23H17F2NO4S/c1-11-6-8-14(20(25)19(11)24)15-10-31-22(18(15)23(29)30)26-21(28)17-13-5-3-2-4-12(13)7-9-16(17)27/h2-10,23,27,29-30H,1H3,(H,26,28) |
| InChIKey | LSWOFKZMMRLMLZ-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.46 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|