C20H15F2NO4S — CID 89458249
4-(2,3-difluoro-4-methylphenyl)-2-[(2-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid (PubChem CID 89458249) has the molecular formula C20H15F2NO4S and a molecular weight of 403.41 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-methylphenyl)-2-[(2-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(2,3-difluoro-4-methylphenyl)-2-[(2-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89458249 |
| Molecular Formula | C20H15F2NO4S |
| Molecular Weight | 403.41 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | 4-(2,3-difluoro-4-methylphenyl)-2-[(2-hydroxy-3-methylbenzoyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1cccc(C(=O)Nc2scc(-c3ccc(C)c(F)c3F)c2C(=O)O)c1O |
| InChI | InChI=1S/C20H15F2NO4S/c1-9-6-7-11(16(22)15(9)21)13-8-28-19(14(13)20(26)27)23-18(25)12-5-3-4-10(2)17(12)24/h3-8,24H,1-2H3,(H,23,25)(H,26,27) |
| InChIKey | QKTKAYMRPSTXOT-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 86.63 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.41 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|