C26H24F2N2O3S — CID 91384531
4-(2,3-difluoro-4-methylphenyl)-2-[2-(2-methylphenyl)iminohept-3-enoylamino]thiophene-3-carboxylic acid (PubChem CID 91384531) has the molecular formula C26H24F2N2O3S and a molecular weight of 482.55 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-methylphenyl)-2-[2-(2-methylphenyl)iminohept-3-enoylamino]thiophene-3-carboxylic acid.
| Compound Name | 4-(2,3-difluoro-4-methylphenyl)-2-[2-(2-methylphenyl)iminohept-3-enoylamino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 91384531 |
| Molecular Formula | C26H24F2N2O3S |
| Molecular Weight | 482.55 g/mol |
| Exact Mass | 482.15 |
| IUPAC Name | 4-(2,3-difluoro-4-methylphenyl)-2-[2-(2-methylphenyl)iminohept-3-enoylamino]thiophene-3-carboxylic acid |
| SMILES | CCCC=C/C(=N\c1ccccc1C)C(=O)Nc1scc(-c2ccc(C)c(F)c2F)c1C(=O)O |
| InChI | InChI=1S/C26H24F2N2O3S/c1-4-5-6-11-20(29-19-10-8-7-9-15(19)2)24(31)30-25-21(26(32)33)18(14-34-25)17-13-12-16(3)22(27)23(17)28/h6-14H,4-5H2,1-3H3,(H,30,31)(H,32,33)/b11-6?,29-20+ |
| InChIKey | SNFVRSRSCLJBNC-IXBUGFPBSA-N |
| XLogP | 7.08 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.55 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|