C20H11ClF2N2O3S2 — CID 53380517
2-[(5-chloro-1,3-benzothiazole-2-carbonyl)amino]-4-(2,3-difluoro-4-methylphenyl)thiophene-3-carboxylic acid (PubChem CID 53380517) has the molecular formula C20H11ClF2N2O3S2 and a molecular weight of 464.90 g/mol. Its IUPAC name is 2-[(5-chloro-1,3-benzothiazole-2-carbonyl)amino]-4-(2,3-difluoro-4-methylphenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(5-chloro-1,3-benzothiazole-2-carbonyl)amino]-4-(2,3-difluoro-4-methylphenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 53380517 |
| Molecular Formula | C20H11ClF2N2O3S2 |
| Molecular Weight | 464.90 g/mol |
| Exact Mass | 463.99 |
| IUPAC Name | 2-[(5-chloro-1,3-benzothiazole-2-carbonyl)amino]-4-(2,3-difluoro-4-methylphenyl)thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3nc4cc(Cl)ccc4s3)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C20H11ClF2N2O3S2/c1-8-2-4-10(16(23)15(8)22)11-7-29-18(14(11)20(27)28)25-17(26)19-24-12-6-9(21)3-5-13(12)30-19/h2-7H,1H3,(H,25,26)(H,27,28) |
| InChIKey | WOJOGBQGTHRKCU-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.90 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|