C17H10F2N2O5S2 — CID 123420348
4-(2,3-difluoro-4-methylphenyl)-2-[(3-hydroxy-5-nitrosothiophene-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 123420348) has the molecular formula C17H10F2N2O5S2 and a molecular weight of 424.41 g/mol. Its IUPAC name is 4-(2,3-difluoro-4-methylphenyl)-2-[(3-hydroxy-5-nitrosothiophene-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(2,3-difluoro-4-methylphenyl)-2-[(3-hydroxy-5-nitrosothiophene-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 123420348 |
| Molecular Formula | C17H10F2N2O5S2 |
| Molecular Weight | 424.41 g/mol |
| Exact Mass | 424.00 |
| IUPAC Name | 4-(2,3-difluoro-4-methylphenyl)-2-[(3-hydroxy-5-nitrosothiophene-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1ccc(-c2csc(NC(=O)c3sc(N=O)cc3O)c2C(=O)O)c(F)c1F |
| InChI | InChI=1S/C17H10F2N2O5S2/c1-6-2-3-7(13(19)12(6)18)8-5-27-16(11(8)17(24)25)20-15(23)14-9(22)4-10(21-26)28-14/h2-5,22H,1H3,(H,20,23)(H,24,25) |
| InChIKey | ZWAVKTGWDMQWOA-UHFFFAOYSA-N |
| XLogP | 5.12 |
| TPSA | 116.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.41 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'thiophene_hydroxy(28)', 'substructure': 'N/A'} |
|---|