C20H13ClN2O3S2 — CID 89457991
4-(4-chlorophenyl)-2-[(7-methyl-1,3-benzothiazole-2-carbonyl)amino]thiophene-3-carboxylic acid (PubChem CID 89457991) has the molecular formula C20H13ClN2O3S2 and a molecular weight of 428.92 g/mol. Its IUPAC name is 4-(4-chlorophenyl)-2-[(7-methyl-1,3-benzothiazole-2-carbonyl)amino]thiophene-3-carboxylic acid.
| Compound Name | 4-(4-chlorophenyl)-2-[(7-methyl-1,3-benzothiazole-2-carbonyl)amino]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 89457991 |
| Molecular Formula | C20H13ClN2O3S2 |
| Molecular Weight | 428.92 g/mol |
| Exact Mass | 428.01 |
| IUPAC Name | 4-(4-chlorophenyl)-2-[(7-methyl-1,3-benzothiazole-2-carbonyl)amino]thiophene-3-carboxylic acid |
| SMILES | Cc1cccc2nc(C(=O)Nc3scc(-c4ccc(Cl)cc4)c3C(=O)O)sc12 |
| InChI | InChI=1S/C20H13ClN2O3S2/c1-10-3-2-4-14-16(10)28-19(22-14)17(24)23-18-15(20(25)26)13(9-27-18)11-5-7-12(21)8-6-11/h2-9H,1H3,(H,23,24)(H,25,26) |
| InChIKey | NCXVKJXUBOUTOO-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 79.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.92 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|