C17H11Cl2NO5S3 — CID 67225341
2-[(3-chloro-4-methylsulfonylthiophene-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid (PubChem CID 67225341) has the molecular formula C17H11Cl2NO5S3 and a molecular weight of 476.38 g/mol. Its IUPAC name is 2-[(3-chloro-4-methylsulfonylthiophene-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid.
| Compound Name | 2-[(3-chloro-4-methylsulfonylthiophene-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 67225341 |
| Molecular Formula | C17H11Cl2NO5S3 |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 474.92 |
| IUPAC Name | 2-[(3-chloro-4-methylsulfonylthiophene-2-carbonyl)amino]-4-(4-chlorophenyl)thiophene-3-carboxylic acid |
| SMILES | CS(=O)(=O)c1csc(C(=O)Nc2scc(-c3ccc(Cl)cc3)c2C(=O)O)c1Cl |
| InChI | InChI=1S/C17H11Cl2NO5S3/c1-28(24,25)11-7-26-14(13(11)19)15(21)20-16-12(17(22)23)10(6-27-16)8-2-4-9(18)5-3-8/h2-7H,1H3,(H,20,21)(H,22,23) |
| InChIKey | IWKQEPARFGXEQV-UHFFFAOYSA-N |
| XLogP | 5.14 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 5.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|