C16H10BrNO3S2 — CID 58295605
4-(2-bromophenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylic acid (PubChem CID 58295605) has the molecular formula C16H10BrNO3S2 and a molecular weight of 408.30 g/mol. Its IUPAC name is 4-(2-bromophenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylic acid.
| Compound Name | 4-(2-bromophenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 58295605 |
| Molecular Formula | C16H10BrNO3S2 |
| Molecular Weight | 408.30 g/mol |
| Exact Mass | 406.93 |
| IUPAC Name | 4-(2-bromophenyl)-2-(thiophene-2-carbonylamino)thiophene-3-carboxylic acid |
| SMILES | O=C(Nc1scc(-c2ccccc2Br)c1C(=O)O)c1cccs1 |
| InChI | InChI=1S/C16H10BrNO3S2/c17-11-5-2-1-4-9(11)10-8-23-15(13(10)16(20)21)18-14(19)12-6-3-7-22-12/h1-8H,(H,18,19)(H,20,21) |
| InChIKey | ZSPTUNQOGBPAMU-UHFFFAOYSA-N |
| XLogP | 5.19 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.30 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|