C36H20BrCl3N2O5S2 — CID 91318896
[4-(2-bromophenyl)-2-[(4-chlorobenzoyl)amino]thiophene-3-carbonyl] 2-[(4-chlorobenzoyl)amino]-4-(3-chlorophenyl)thiophene-3-carboxylate (PubChem CID 91318896) has the molecular formula C36H20BrCl3N2O5S2 and a molecular weight of 810.96 g/mol. Its IUPAC name is [4-(2-bromophenyl)-2-[(4-chlorobenzoyl)amino]thiophene-3-carbonyl] 2-[(4-chlorobenzoyl)amino]-4-(3-chlorophenyl)thiophene-3-carboxylate.
| Compound Name | [4-(2-bromophenyl)-2-[(4-chlorobenzoyl)amino]thiophene-3-carbonyl] 2-[(4-chlorobenzoyl)amino]-4-(3-chlorophenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91318896 |
| Molecular Formula | C36H20BrCl3N2O5S2 |
| Molecular Weight | 810.96 g/mol |
| Exact Mass | 807.91 |
| IUPAC Name | [4-(2-bromophenyl)-2-[(4-chlorobenzoyl)amino]thiophene-3-carbonyl] 2-[(4-chlorobenzoyl)amino]-4-(3-chlorophenyl)thiophene-3-carboxylate |
| SMILES | O=C(Nc1scc(-c2cccc(Cl)c2)c1C(=O)OC(=O)c1c(-c2ccccc2Br)csc1NC(=O)c1ccc(Cl)cc1)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C36H20BrCl3N2O5S2/c37-28-7-2-1-6-25(28)27-18-49-34(42-32(44)20-10-14-23(39)15-11-20)30(27)36(46)47-35(45)29-26(21-4-3-5-24(40)16-21)17-48-33(29)41-31(43)19-8-12-22(38)13-9-19/h1-18H,(H,41,43)(H,42,44) |
| InChIKey | KLDVABZPENSHNN-UHFFFAOYSA-N |
| XLogP | 11.37 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.96 |
| LogP ≤ 5 | 11.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|