C38H25Cl2FN2O5S2 — CID 91389516
[4-(4-chlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carbonyl] 4-(4-chlorophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate (PubChem CID 91389516) has the molecular formula C38H25Cl2FN2O5S2 and a molecular weight of 743.67 g/mol. Its IUPAC name is [4-(4-chlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carbonyl] 4-(4-chlorophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate.
| Compound Name | [4-(4-chlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carbonyl] 4-(4-chlorophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91389516 |
| Molecular Formula | C38H25Cl2FN2O5S2 |
| Molecular Weight | 743.67 g/mol |
| Exact Mass | 742.06 |
| IUPAC Name | [4-(4-chlorophenyl)-2-[(3-fluorobenzoyl)amino]thiophene-3-carbonyl] 4-(4-chlorophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate |
| SMILES | O=C(CCc1ccccc1)Nc1scc(-c2ccc(Cl)cc2)c1C(=O)OC(=O)c1c(-c2ccc(Cl)cc2)csc1NC(=O)c1cccc(F)c1 |
| InChI | InChI=1S/C38H25Cl2FN2O5S2/c39-26-14-10-23(11-15-26)29-20-49-35(42-31(44)18-9-22-5-2-1-3-6-22)32(29)37(46)48-38(47)33-30(24-12-16-27(40)17-13-24)21-50-36(33)43-34(45)25-7-4-8-28(41)19-25/h1-8,10-17,19-21H,9,18H2,(H,42,44)(H,43,45) |
| InChIKey | YGMIROGEDMAXNK-UHFFFAOYSA-N |
| XLogP | 10.41 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 743.67 |
| LogP ≤ 5 | 10.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|