C40H29Br2FN2O5S2 — CID 91085298
[4-(4-bromophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carbonyl] 4-(4-bromophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate (PubChem CID 91085298) has the molecular formula C40H29Br2FN2O5S2 and a molecular weight of 860.62 g/mol. Its IUPAC name is [4-(4-bromophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carbonyl] 4-(4-bromophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate.
| Compound Name | [4-(4-bromophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carbonyl] 4-(4-bromophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 91085298 |
| Molecular Formula | C40H29Br2FN2O5S2 |
| Molecular Weight | 860.62 g/mol |
| Exact Mass | 857.99 |
| IUPAC Name | [4-(4-bromophenyl)-2-[3-(4-fluorophenyl)propanoylamino]thiophene-3-carbonyl] 4-(4-bromophenyl)-2-(3-phenylpropanoylamino)thiophene-3-carboxylate |
| SMILES | O=C(CCc1ccccc1)Nc1scc(-c2ccc(Br)cc2)c1C(=O)OC(=O)c1c(-c2ccc(Br)cc2)csc1NC(=O)CCc1ccc(F)cc1 |
| InChI | InChI=1S/C40H29Br2FN2O5S2/c41-28-14-10-26(11-15-28)31-22-51-37(44-33(46)20-8-24-4-2-1-3-5-24)35(31)39(48)50-40(49)36-32(27-12-16-29(42)17-13-27)23-52-38(36)45-34(47)21-9-25-6-18-30(43)19-7-25/h1-7,10-19,22-23H,8-9,20-21H2,(H,44,46)(H,45,47) |
| InChIKey | QVAZJEQWYDARDO-UHFFFAOYSA-N |
| XLogP | 10.95 |
| TPSA | 101.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 860.62 |
| LogP ≤ 5 | 10.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|