C22H20FNO4S — CID 3544782
methyl 4-(4-fluorophenyl)-2-[3-(4-methoxyphenyl)propanoylamino]thiophene-3-carboxylate (PubChem CID 3544782) has the molecular formula C22H20FNO4S and a molecular weight of 413.47 g/mol. Its IUPAC name is methyl 4-(4-fluorophenyl)-2-[3-(4-methoxyphenyl)propanoylamino]thiophene-3-carboxylate.
| Compound Name | methyl 4-(4-fluorophenyl)-2-[3-(4-methoxyphenyl)propanoylamino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 3544782 |
| Molecular Formula | C22H20FNO4S |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.11 |
| IUPAC Name | methyl 4-(4-fluorophenyl)-2-[3-(4-methoxyphenyl)propanoylamino]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccc(F)cc2)csc1NC(=O)CCc1ccc(OC)cc1 |
| InChI | InChI=1S/C22H20FNO4S/c1-27-17-10-3-14(4-11-17)5-12-19(25)24-21-20(22(26)28-2)18(13-29-21)15-6-8-16(23)9-7-15/h3-4,6-11,13H,5,12H2,1-2H3,(H,24,25) |
| InChIKey | BSROXCNSTBIICF-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|