C17H12N2O4 — CID 6282137
2-[[(Z)-2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzoic acid (PubChem CID 6282137) has the molecular formula C17H12N2O4 and a molecular weight of 308.29 g/mol. Its IUPAC name is 2-[[(Z)-2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzoic acid.
| Compound Name | 2-[[(Z)-2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzoic acid |
|---|---|
| PubChem CID | 6282137 |
| Molecular Formula | C17H12N2O4 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.08 |
| IUPAC Name | 2-[[(Z)-2-(1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]benzoic acid |
| SMILES | O=C/C(=C\Nc1ccccc1C(=O)O)c1nc2ccccc2o1 |
| InChI | InChI=1S/C17H12N2O4/c20-10-11(16-19-14-7-3-4-8-15(14)23-16)9-18-13-6-2-1-5-12(13)17(21)22/h1-10,18H,(H,21,22)/b11-9+ |
| InChIKey | NQALQZRFEREZGI-PKNBQFBNSA-N |
| XLogP | 3.18 |
| TPSA | 92.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|