C16H9Cl3N2O2 — CID 98430662
(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(2,3-dichloroanilino)prop-2-enal (PubChem CID 98430662) has the molecular formula C16H9Cl3N2O2 and a molecular weight of 367.62 g/mol. Its IUPAC name is (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(2,3-dichloroanilino)prop-2-enal.
| Compound Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(2,3-dichloroanilino)prop-2-enal |
|---|---|
| PubChem CID | 98430662 |
| Molecular Formula | C16H9Cl3N2O2 |
| Molecular Weight | 367.62 g/mol |
| Exact Mass | 365.97 |
| IUPAC Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(2,3-dichloroanilino)prop-2-enal |
| SMILES | O=C/C(=C/Nc1cccc(Cl)c1Cl)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C16H9Cl3N2O2/c17-10-4-5-14-13(6-10)21-16(23-14)9(8-22)7-20-12-3-1-2-11(18)15(12)19/h1-8,20H/b9-7- |
| InChIKey | SVZTWAQXRZOSPI-CLFYSBASSA-N |
| XLogP | 5.44 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.62 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|