C21H20ClN3O4S — CID 18528496
(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-piperidin-1-ylsulfonylanilino)prop-2-enal (PubChem CID 18528496) has the molecular formula C21H20ClN3O4S and a molecular weight of 445.93 g/mol. Its IUPAC name is (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-piperidin-1-ylsulfonylanilino)prop-2-enal.
| Compound Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-piperidin-1-ylsulfonylanilino)prop-2-enal |
|---|---|
| PubChem CID | 18528496 |
| Molecular Formula | C21H20ClN3O4S |
| Molecular Weight | 445.93 g/mol |
| Exact Mass | 445.09 |
| IUPAC Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(4-piperidin-1-ylsulfonylanilino)prop-2-enal |
| SMILES | O=C/C(=C/Nc1ccc(S(=O)(=O)N2CCCCC2)cc1)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C21H20ClN3O4S/c22-16-4-9-20-19(12-16)24-21(29-20)15(14-26)13-23-17-5-7-18(8-6-17)30(27,28)25-10-2-1-3-11-25/h4-9,12-14,23H,1-3,10-11H2/b15-13- |
| InChIKey | LAUQWTBNZSYPLT-SQFISAMPSA-N |
| XLogP | 4.31 |
| TPSA | 92.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.93 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|