C18H13ClN2O3 — CID 5243016
3-(4-acetylanilino)-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal (PubChem CID 5243016) has the molecular formula C18H13ClN2O3 and a molecular weight of 340.77 g/mol. Its IUPAC name is 3-(4-acetylanilino)-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal.
| Compound Name | 3-(4-acetylanilino)-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal |
|---|---|
| PubChem CID | 5243016 |
| Molecular Formula | C18H13ClN2O3 |
| Molecular Weight | 340.77 g/mol |
| Exact Mass | 340.06 |
| IUPAC Name | 3-(4-acetylanilino)-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal |
| SMILES | CC(=O)c1ccc(NC=C(C=O)c2nc3cc(Cl)ccc3o2)cc1 |
| InChI | InChI=1S/C18H13ClN2O3/c1-11(23)12-2-5-15(6-3-12)20-9-13(10-22)18-21-16-8-14(19)4-7-17(16)24-18/h2-10,20H,1H3 |
| InChIKey | XPGJOQYREWAREG-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 72.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.77 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|