C20H12BrClN2O2 — CID 3625938
3-[(4-bromonaphthalen-1-yl)amino]-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal (PubChem CID 3625938) has the molecular formula C20H12BrClN2O2 and a molecular weight of 427.69 g/mol. Its IUPAC name is 3-[(4-bromonaphthalen-1-yl)amino]-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal.
| Compound Name | 3-[(4-bromonaphthalen-1-yl)amino]-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal |
|---|---|
| PubChem CID | 3625938 |
| Molecular Formula | C20H12BrClN2O2 |
| Molecular Weight | 427.69 g/mol |
| Exact Mass | 425.98 |
| IUPAC Name | 3-[(4-bromonaphthalen-1-yl)amino]-2-(5-chloro-1,3-benzoxazol-2-yl)prop-2-enal |
| SMILES | O=CC(=CNc1ccc(Br)c2ccccc12)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C20H12BrClN2O2/c21-16-6-7-17(15-4-2-1-3-14(15)16)23-10-12(11-25)20-24-18-9-13(22)5-8-19(18)26-20/h1-11,23H |
| InChIKey | OBWKECPGJQTLIR-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.69 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|