C20H13BrN2O2 — CID 4148446
2-(1,3-benzoxazol-2-yl)-3-[(4-bromonaphthalen-1-yl)amino]prop-2-enal (PubChem CID 4148446) has the molecular formula C20H13BrN2O2 and a molecular weight of 393.24 g/mol. Its IUPAC name is 2-(1,3-benzoxazol-2-yl)-3-[(4-bromonaphthalen-1-yl)amino]prop-2-enal.
| Compound Name | 2-(1,3-benzoxazol-2-yl)-3-[(4-bromonaphthalen-1-yl)amino]prop-2-enal |
|---|---|
| PubChem CID | 4148446 |
| Molecular Formula | C20H13BrN2O2 |
| Molecular Weight | 393.24 g/mol |
| Exact Mass | 392.02 |
| IUPAC Name | 2-(1,3-benzoxazol-2-yl)-3-[(4-bromonaphthalen-1-yl)amino]prop-2-enal |
| SMILES | O=CC(=CNc1ccc(Br)c2ccccc12)c1nc2ccccc2o1 |
| InChI | InChI=1S/C20H13BrN2O2/c21-16-9-10-17(15-6-2-1-5-14(15)16)22-11-13(12-24)20-23-18-7-3-4-8-19(18)25-20/h1-12,22H |
| InChIKey | WLLFGLNWUWGCEB-UHFFFAOYSA-N |
| XLogP | 5.40 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.24 |
| LogP ≤ 5 | 5.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|