C17H18ClN5O2 — CID 51588444
(E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-ylamino)prop-2-enal (PubChem CID 51588444) has the molecular formula C17H18ClN5O2 and a molecular weight of 359.82 g/mol. Its IUPAC name is (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-ylamino)prop-2-enal.
| Compound Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-ylamino)prop-2-enal |
|---|---|
| PubChem CID | 51588444 |
| Molecular Formula | C17H18ClN5O2 |
| Molecular Weight | 359.82 g/mol |
| Exact Mass | 359.11 |
| IUPAC Name | (E)-2-(5-chloro-1,3-benzoxazol-2-yl)-3-(1,3,5-triazatricyclo[3.3.1.13,7]decan-7-ylamino)prop-2-enal |
| SMILES | O=C/C(=C/NC12CN3CN(CN(C3)C1)C2)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C17H18ClN5O2/c18-13-1-2-15-14(3-13)20-16(25-15)12(5-24)4-19-17-6-21-9-22(7-17)11-23(8-17)10-21/h1-5,19H,6-11H2/b12-4- |
| InChIKey | DZRHXYDHBSEFHR-QCDXTXTGSA-N |
| XLogP | 1.17 |
| TPSA | 64.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.82 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|