C24H20ClN3O5S — CID 4186655
4-[[2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(2-methylphenyl)benzenesulfonamide (PubChem CID 4186655) has the molecular formula C24H20ClN3O5S and a molecular weight of 497.96 g/mol. Its IUPAC name is 4-[[2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(2-methylphenyl)benzenesulfonamide.
| Compound Name | 4-[[2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(2-methylphenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 4186655 |
| Molecular Formula | C24H20ClN3O5S |
| Molecular Weight | 497.96 g/mol |
| Exact Mass | 497.08 |
| IUPAC Name | 4-[[2-(5-chloro-1,3-benzoxazol-2-yl)-3-oxoprop-1-enyl]amino]-3-methoxy-N-(2-methylphenyl)benzenesulfonamide |
| SMILES | COc1cc(S(=O)(=O)Nc2ccccc2C)ccc1NC=C(C=O)c1nc2cc(Cl)ccc2o1 |
| InChI | InChI=1S/C24H20ClN3O5S/c1-15-5-3-4-6-19(15)28-34(30,31)18-8-9-20(23(12-18)32-2)26-13-16(14-29)24-27-21-11-17(25)7-10-22(21)33-24/h3-14,26,28H,1-2H3 |
| InChIKey | WXOXPLHERXEXEN-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.96 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|