C22H15ClN4O3S — CID 6092175
4-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(4-chlorophenyl)benzenesulfonamide (PubChem CID 6092175) has the molecular formula C22H15ClN4O3S and a molecular weight of 450.91 g/mol. Its IUPAC name is 4-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(4-chlorophenyl)benzenesulfonamide.
| Compound Name | 4-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(4-chlorophenyl)benzenesulfonamide |
|---|---|
| PubChem CID | 6092175 |
| Molecular Formula | C22H15ClN4O3S |
| Molecular Weight | 450.91 g/mol |
| Exact Mass | 450.06 |
| IUPAC Name | 4-[[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]amino]-N-(4-chlorophenyl)benzenesulfonamide |
| SMILES | N#C/C(=C\Nc1ccc(S(=O)(=O)Nc2ccc(Cl)cc2)cc1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C22H15ClN4O3S/c23-16-5-7-18(8-6-16)27-31(28,29)19-11-9-17(10-12-19)25-14-15(13-24)22-26-20-3-1-2-4-21(20)30-22/h1-12,14,25,27H/b15-14+ |
| InChIKey | BFWZYPTVTZRNIF-CCEZHUSRSA-N |
| XLogP | 5.26 |
| TPSA | 108.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.91 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|