C15H9ClN4O — CID 5411417
(E)-2-(1,3-benzoxazol-2-yl)-3-[(5-chloro-2-pyridinyl)amino]prop-2-enenitrile (PubChem CID 5411417) has the molecular formula C15H9ClN4O and a molecular weight of 296.72 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-[(5-chloro-2-pyridinyl)amino]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-[(5-chloro-2-pyridinyl)amino]prop-2-enenitrile |
|---|---|
| PubChem CID | 5411417 |
| Molecular Formula | C15H9ClN4O |
| Molecular Weight | 296.72 g/mol |
| Exact Mass | 296.05 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-[(5-chloro-2-pyridinyl)amino]prop-2-enenitrile |
| SMILES | N#C/C(=C\Nc1ccc(Cl)cn1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C15H9ClN4O/c16-11-5-6-14(19-9-11)18-8-10(7-17)15-20-12-3-1-2-4-13(12)21-15/h1-6,8-9H,(H,18,19)/b10-8+ |
| InChIKey | LCKJEVRSNRHJCM-CSKARUKUSA-N |
| XLogP | 3.85 |
| TPSA | 74.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.72 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|