C16H9BrN2O — CID 6304292
(E)-2-(1,3-benzoxazol-2-yl)-3-(3-bromophenyl)prop-2-enenitrile (PubChem CID 6304292) has the molecular formula C16H9BrN2O and a molecular weight of 325.17 g/mol. Its IUPAC name is (E)-2-(1,3-benzoxazol-2-yl)-3-(3-bromophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(3-bromophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 6304292 |
| Molecular Formula | C16H9BrN2O |
| Molecular Weight | 325.17 g/mol |
| Exact Mass | 323.99 |
| IUPAC Name | (E)-2-(1,3-benzoxazol-2-yl)-3-(3-bromophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cccc(Br)c1)c1nc2ccccc2o1 |
| InChI | InChI=1S/C16H9BrN2O/c17-13-5-3-4-11(9-13)8-12(10-18)16-19-14-6-1-2-7-15(14)20-16/h1-9H/b12-8+ |
| InChIKey | DBNVJWBVLWRGMQ-XYOKQWHBSA-N |
| XLogP | 4.65 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.17 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|