C23H14BrClN2O5S — CID 126084835
[4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126084835) has the molecular formula C23H14BrClN2O5S and a molecular weight of 545.80 g/mol. Its IUPAC name is [4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126084835 |
| Molecular Formula | C23H14BrClN2O5S |
| Molecular Weight | 545.80 g/mol |
| Exact Mass | 543.95 |
| IUPAC Name | [4-[(E)-2-(1,3-benzoxazol-2-yl)-2-cyanoethenyl]-2-bromo-6-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(/C=C(\C#N)c2nc3ccccc3o2)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C23H14BrClN2O5S/c1-30-21-12-14(10-15(13-26)23-27-19-4-2-3-5-20(19)31-23)11-18(24)22(21)32-33(28,29)17-8-6-16(25)7-9-17/h2-12H,1H3/b15-10+ |
| InChIKey | IHIFMAXFHWKBCD-XNTDXEJSSA-N |
| XLogP | 6.08 |
| TPSA | 102.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.80 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|