C22H12Cl3N3O3S — CID 126071085
[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenyl] 4-chlorobenzenesulfonate (PubChem CID 126071085) has the molecular formula C22H12Cl3N3O3S and a molecular weight of 504.78 g/mol. Its IUPAC name is [4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenyl] 4-chlorobenzenesulfonate.
| Compound Name | [4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126071085 |
| Molecular Formula | C22H12Cl3N3O3S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 502.97 |
| IUPAC Name | [4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]-2,6-dichlorophenyl] 4-chlorobenzenesulfonate |
| SMILES | N#C/C(=C\c1cc(Cl)c(OS(=O)(=O)c2ccc(Cl)cc2)c(Cl)c1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H12Cl3N3O3S/c23-15-5-7-16(8-6-15)32(29,30)31-21-17(24)10-13(11-18(21)25)9-14(12-26)22-27-19-3-1-2-4-20(19)28-22/h1-11H,(H,27,28)/b14-9+ |
| InChIKey | FLCRKCKFDPKJDN-NTEUORMPSA-N |
| XLogP | 6.35 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 6.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|