C22H15N3O3S — CID 126072028
[4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]phenyl] benzenesulfonate (PubChem CID 126072028) has the molecular formula C22H15N3O3S and a molecular weight of 401.45 g/mol. Its IUPAC name is [4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]phenyl] benzenesulfonate.
| Compound Name | [4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 126072028 |
| Molecular Formula | C22H15N3O3S |
| Molecular Weight | 401.45 g/mol |
| Exact Mass | 401.08 |
| IUPAC Name | [4-[(E)-2-(1H-benzimidazol-2-yl)-2-cyanoethenyl]phenyl] benzenesulfonate |
| SMILES | N#C/C(=C\c1ccc(OS(=O)(=O)c2ccccc2)cc1)c1nc2ccccc2[nH]1 |
| InChI | InChI=1S/C22H15N3O3S/c23-15-17(22-24-20-8-4-5-9-21(20)25-22)14-16-10-12-18(13-11-16)28-29(26,27)19-6-2-1-3-7-19/h1-14H,(H,24,25)/b17-14+ |
| InChIKey | ILRLWNCBHDMSSV-SAPNQHFASA-N |
| XLogP | 4.39 |
| TPSA | 95.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.45 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|