C16H10N2O3S — CID 22899744
[4-(2,2-dicyanoethenyl)phenyl] benzenesulfonate (PubChem CID 22899744) has the molecular formula C16H10N2O3S and a molecular weight of 310.33 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] benzenesulfonate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] benzenesulfonate |
|---|---|
| PubChem CID | 22899744 |
| Molecular Formula | C16H10N2O3S |
| Molecular Weight | 310.33 g/mol |
| Exact Mass | 310.04 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] benzenesulfonate |
| SMILES | N#CC(C#N)=Cc1ccc(OS(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C16H10N2O3S/c17-11-14(12-18)10-13-6-8-15(9-7-13)21-22(19,20)16-4-2-1-3-5-16/h1-10H |
| InChIKey | MBMVEWNWZDBEET-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.33 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|