C17H12N2O4S — CID 50871486
[4-(2,2-dicyanoethenyl)-2-methoxyphenyl] benzenesulfonate (PubChem CID 50871486) has the molecular formula C17H12N2O4S and a molecular weight of 340.36 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)-2-methoxyphenyl] benzenesulfonate.
| Compound Name | [4-(2,2-dicyanoethenyl)-2-methoxyphenyl] benzenesulfonate |
|---|---|
| PubChem CID | 50871486 |
| Molecular Formula | C17H12N2O4S |
| Molecular Weight | 340.36 g/mol |
| Exact Mass | 340.05 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)-2-methoxyphenyl] benzenesulfonate |
| SMILES | COc1cc(C=C(C#N)C#N)ccc1OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C17H12N2O4S/c1-22-17-10-13(9-14(11-18)12-19)7-8-16(17)23-24(20,21)15-5-3-2-4-6-15/h2-10H,1H3 |
| InChIKey | NSDAPYXSRVWCBM-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 100.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|