C17H13F2NO4S — CID 2956256
2-(benzenesulfonyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 2956256) has the molecular formula C17H13F2NO4S and a molecular weight of 365.36 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2956256 |
| Molecular Formula | C17H13F2NO4S |
| Molecular Weight | 365.36 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[4-(difluoromethoxy)-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)S(=O)(=O)c2ccccc2)ccc1OC(F)F |
| InChI | InChI=1S/C17H13F2NO4S/c1-23-16-10-12(7-8-15(16)24-17(18)19)9-14(11-20)25(21,22)13-5-3-2-4-6-13/h2-10,17H,1H3 |
| InChIKey | ZLIAGRIGKPJXKL-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.36 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|