C23H17ClFNO4S — CID 1186479
(Z)-2-(benzenesulfonyl)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile (PubChem CID 1186479) has the molecular formula C23H17ClFNO4S and a molecular weight of 457.91 g/mol. Its IUPAC name is (Z)-2-(benzenesulfonyl)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile.
| Compound Name | (Z)-2-(benzenesulfonyl)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 1186479 |
| Molecular Formula | C23H17ClFNO4S |
| Molecular Weight | 457.91 g/mol |
| Exact Mass | 457.06 |
| IUPAC Name | (Z)-2-(benzenesulfonyl)-3-[4-[(2-chloro-6-fluorophenyl)methoxy]-3-methoxyphenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(/C#N)S(=O)(=O)c2ccccc2)ccc1OCc1c(F)cccc1Cl |
| InChI | InChI=1S/C23H17ClFNO4S/c1-29-23-13-16(12-18(14-26)31(27,28)17-6-3-2-4-7-17)10-11-22(23)30-15-19-20(24)8-5-9-21(19)25/h2-13H,15H2,1H3/b18-12- |
| InChIKey | GPEOQGQHYBSJSK-PDGQHHTCSA-N |
| XLogP | 5.41 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.91 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|