C24H16Cl2F3NO4S — CID 2414859
(E)-2-(2,5-dichlorophenyl)sulfonyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile (PubChem CID 2414859) has the molecular formula C24H16Cl2F3NO4S and a molecular weight of 542.36 g/mol. Its IUPAC name is (E)-2-(2,5-dichlorophenyl)sulfonyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 2414859 |
| Molecular Formula | C24H16Cl2F3NO4S |
| Molecular Weight | 542.36 g/mol |
| Exact Mass | 541.01 |
| IUPAC Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-[3-methoxy-4-[[3-(trifluoromethyl)phenyl]methoxy]phenyl]prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)S(=O)(=O)c2cc(Cl)ccc2Cl)ccc1OCc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C24H16Cl2F3NO4S/c1-33-22-11-15(10-19(13-30)35(31,32)23-12-18(25)6-7-20(23)26)5-8-21(22)34-14-16-3-2-4-17(9-16)24(27,28)29/h2-12H,14H2,1H3/b19-10+ |
| InChIKey | YGCUELZTAGBSRC-VXLYETTFSA-N |
| XLogP | 6.94 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.36 |
| LogP ≤ 5 | 6.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|