C18H15Cl2NO5S — CID 2714192
(E)-2-(2,5-dichlorophenyl)sulfonyl-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile (PubChem CID 2714192) has the molecular formula C18H15Cl2NO5S and a molecular weight of 428.29 g/mol. Its IUPAC name is (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2714192 |
| Molecular Formula | C18H15Cl2NO5S |
| Molecular Weight | 428.29 g/mol |
| Exact Mass | 427.00 |
| IUPAC Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(3,4,5-trimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)S(=O)(=O)c2cc(Cl)ccc2Cl)cc(OC)c1OC |
| InChI | InChI=1S/C18H15Cl2NO5S/c1-24-15-7-11(8-16(25-2)18(15)26-3)6-13(10-21)27(22,23)17-9-12(19)4-5-14(17)20/h4-9H,1-3H3/b13-6+ |
| InChIKey | GXHNOXPCWUGQES-AWNIVKPZSA-N |
| XLogP | 4.36 |
| TPSA | 85.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.29 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|