C17H13Cl2NO4S — CID 99819273
(E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2,6-dimethoxyphenyl)prop-2-enenitrile (PubChem CID 99819273) has the molecular formula C17H13Cl2NO4S and a molecular weight of 398.27 g/mol. Its IUPAC name is (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2,6-dimethoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2,6-dimethoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 99819273 |
| Molecular Formula | C17H13Cl2NO4S |
| Molecular Weight | 398.27 g/mol |
| Exact Mass | 396.99 |
| IUPAC Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2,6-dimethoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cccc(OC)c1/C=C(\C#N)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C17H13Cl2NO4S/c1-23-15-4-3-5-16(24-2)13(15)9-12(10-20)25(21,22)17-8-11(18)6-7-14(17)19/h3-9H,1-2H3/b12-9+ |
| InChIKey | VPUGONQYNRBNCJ-FMIVXFBMSA-N |
| XLogP | 4.35 |
| TPSA | 76.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.27 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|