C15H9Cl2NO2S — CID 733311
(E)-2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile (PubChem CID 733311) has the molecular formula C15H9Cl2NO2S and a molecular weight of 338.22 g/mol. Its IUPAC name is (E)-2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 733311 |
| Molecular Formula | C15H9Cl2NO2S |
| Molecular Weight | 338.22 g/mol |
| Exact Mass | 336.97 |
| IUPAC Name | (E)-2-(benzenesulfonyl)-3-(2,4-dichlorophenyl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(Cl)cc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H9Cl2NO2S/c16-12-7-6-11(15(17)9-12)8-14(10-18)21(19,20)13-4-2-1-3-5-13/h1-9H/b14-8+ |
| InChIKey | YLIMOSOKIMUSCO-RIYZIHGNSA-N |
| XLogP | 4.33 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.22 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|