C15H8Cl3NO2S — CID 1193897
2-(benzenesulfonyl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile (PubChem CID 1193897) has the molecular formula C15H8Cl3NO2S and a molecular weight of 372.66 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1193897 |
| Molecular Formula | C15H8Cl3NO2S |
| Molecular Weight | 372.66 g/mol |
| Exact Mass | 370.93 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(2,3,6-trichlorophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1c(Cl)ccc(Cl)c1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C15H8Cl3NO2S/c16-13-6-7-14(17)15(18)12(13)8-11(9-19)22(20,21)10-4-2-1-3-5-10/h1-8H |
| InChIKey | GBWVDUYXXRKFAR-UHFFFAOYSA-N |
| XLogP | 4.99 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.66 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|