C22H15Cl2NO3S — CID 4586674
2-(benzenesulfonyl)-3-[3-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 4586674) has the molecular formula C22H15Cl2NO3S and a molecular weight of 444.34 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-[3-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-[3-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4586674 |
| Molecular Formula | C22H15Cl2NO3S |
| Molecular Weight | 444.34 g/mol |
| Exact Mass | 443.01 |
| IUPAC Name | 2-(benzenesulfonyl)-3-[3-[(3,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1cccc(OCc2ccc(Cl)c(Cl)c2)c1)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C22H15Cl2NO3S/c23-21-10-9-17(13-22(21)24)15-28-18-6-4-5-16(11-18)12-20(14-25)29(26,27)19-7-2-1-3-8-19/h1-13H,15H2 |
| InChIKey | NCSANJSYMGFVBG-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.34 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|