C13H7Cl2NO2S2 — CID 2739774
2-(benzenesulfonyl)-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile (PubChem CID 2739774) has the molecular formula C13H7Cl2NO2S2 and a molecular weight of 344.24 g/mol. Its IUPAC name is 2-(benzenesulfonyl)-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile.
| Compound Name | 2-(benzenesulfonyl)-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2739774 |
| Molecular Formula | C13H7Cl2NO2S2 |
| Molecular Weight | 344.24 g/mol |
| Exact Mass | 342.93 |
| IUPAC Name | 2-(benzenesulfonyl)-3-(2,5-dichlorothiophen-3-yl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1cc(Cl)sc1Cl)S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C13H7Cl2NO2S2/c14-12-7-9(13(15)19-12)6-11(8-16)20(17,18)10-4-2-1-3-5-10/h1-7H |
| InChIKey | KXMLHPLOOFYXCT-UHFFFAOYSA-N |
| XLogP | 4.39 |
| TPSA | 57.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.24 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|