C18H13Cl2NO3S — CID 9446922
(E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2-prop-2-enoxyphenyl)prop-2-enenitrile (PubChem CID 9446922) has the molecular formula C18H13Cl2NO3S and a molecular weight of 394.28 g/mol. Its IUPAC name is (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2-prop-2-enoxyphenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2-prop-2-enoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 9446922 |
| Molecular Formula | C18H13Cl2NO3S |
| Molecular Weight | 394.28 g/mol |
| Exact Mass | 393.00 |
| IUPAC Name | (E)-2-(2,5-dichlorophenyl)sulfonyl-3-(2-prop-2-enoxyphenyl)prop-2-enenitrile |
| SMILES | C=CCOc1ccccc1/C=C(\C#N)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C18H13Cl2NO3S/c1-2-9-24-17-6-4-3-5-13(17)10-15(12-21)25(22,23)18-11-14(19)7-8-16(18)20/h2-8,10-11H,1,9H2/b15-10+ |
| InChIKey | WNNAXAWDNMUVDQ-XNTDXEJSSA-N |
| XLogP | 4.90 |
| TPSA | 67.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.28 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|