About 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid
4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid (PubChem CID 9109903) has the molecular formula C16H9Cl2NO4S
and a molecular weight of 382.22 g/mol. Its IUPAC name is 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid.
Molecular Properties
| Compound Name | 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid |
| PubChem CID | 9109903 |
| Molecular Formula | C16H9Cl2NO4S |
| Molecular Weight | 382.22 g/mol |
| Exact Mass | 380.96 |
| IUPAC Name | 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid |
| SMILES | N#C/C(=C\c1ccc(C(=O)O)cc1)S(=O)(=O)c1cc(Cl)ccc1Cl |
| InChI | InChI=1S/C16H9Cl2NO4S/c17-12-5-6-14(18)15(8-12)24(22,23)13(9-19)7-10-1-3-11(4-2-10)16(20)21/h1-8H,(H,20,21)/b13-7+ |
| InChIKey | FTKFVCAAGXFYLO-NTUHNPAUSA-N |
| XLogP | 4.03 |
| TPSA | 95.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 382.22 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|
Analyze 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid?
The IUPAC name of 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid (CID 9109903) is 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid.
What is the SMILES notation for 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid?
The canonical SMILES for 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid is N#C/C(=C\c1ccc(C(=O)O)cc1)S(=O)(=O)c1cc(Cl)ccc1Cl.
What is the InChIKey of 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid?
The InChIKey is FTKFVCAAGXFYLO-NTUHNPAUSA-N. The full InChI is InChI=1S/C16H9Cl2NO4S/c17-12-5-6-14(18)15(8-12)24(22,23)13(9-19)7-10-1-3-11(4-2-10)16(20)21/h1-8H,(H,20,21)/b13-7+.
What are the key properties of 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid?
4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid has a molecular weight of 382.22 g/mol, XLogP of 4.03, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-cyano-2-(2,5-dichlorophenyl)sulfonylethenyl]benzoic acid is sourced from PubChem (CID 9109903), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).