C16H10BrCl2NO4S — CID 76871258
3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-(2,5-dichlorophenyl)sulfonylprop-2-enenitrile (PubChem CID 76871258) has the molecular formula C16H10BrCl2NO4S and a molecular weight of 463.14 g/mol. Its IUPAC name is 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-(2,5-dichlorophenyl)sulfonylprop-2-enenitrile.
| Compound Name | 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-(2,5-dichlorophenyl)sulfonylprop-2-enenitrile |
|---|---|
| PubChem CID | 76871258 |
| Molecular Formula | C16H10BrCl2NO4S |
| Molecular Weight | 463.14 g/mol |
| Exact Mass | 460.89 |
| IUPAC Name | 3-(2-bromo-4-hydroxy-5-methoxyphenyl)-2-(2,5-dichlorophenyl)sulfonylprop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)S(=O)(=O)c2cc(Cl)ccc2Cl)c(Br)cc1O |
| InChI | InChI=1S/C16H10BrCl2NO4S/c1-24-15-5-9(12(17)7-14(15)21)4-11(8-20)25(22,23)16-6-10(18)2-3-13(16)19/h2-7,21H,1H3 |
| InChIKey | SGAOSEIRNMDUCP-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 87.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.14 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|