C17H10Cl2N2O3S — CID 88588582
[4-(2,2-dicyanoethenyl)phenyl] 4,5-dichloro-2-methylbenzenesulfonate (PubChem CID 88588582) has the molecular formula C17H10Cl2N2O3S and a molecular weight of 393.25 g/mol. Its IUPAC name is [4-(2,2-dicyanoethenyl)phenyl] 4,5-dichloro-2-methylbenzenesulfonate.
| Compound Name | [4-(2,2-dicyanoethenyl)phenyl] 4,5-dichloro-2-methylbenzenesulfonate |
|---|---|
| PubChem CID | 88588582 |
| Molecular Formula | C17H10Cl2N2O3S |
| Molecular Weight | 393.25 g/mol |
| Exact Mass | 391.98 |
| IUPAC Name | [4-(2,2-dicyanoethenyl)phenyl] 4,5-dichloro-2-methylbenzenesulfonate |
| SMILES | Cc1cc(Cl)c(Cl)cc1S(=O)(=O)Oc1ccc(C=C(C#N)C#N)cc1 |
| InChI | InChI=1S/C17H10Cl2N2O3S/c1-11-6-15(18)16(19)8-17(11)25(22,23)24-14-4-2-12(3-5-14)7-13(9-20)10-21/h2-8H,1H3 |
| InChIKey | OBNISXKYIIBLJE-UHFFFAOYSA-N |
| XLogP | 4.50 |
| TPSA | 90.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.25 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_cyano_A(19)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|