C23H15ClN4O8S — CID 3789641
[4-[3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-methyl-3-nitrobenzenesulfonate (PubChem CID 3789641) has the molecular formula C23H15ClN4O8S and a molecular weight of 542.91 g/mol. Its IUPAC name is [4-[3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-methyl-3-nitrobenzenesulfonate.
| Compound Name | [4-[3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
|---|---|
| PubChem CID | 3789641 |
| Molecular Formula | C23H15ClN4O8S |
| Molecular Weight | 542.91 g/mol |
| Exact Mass | 542.03 |
| IUPAC Name | [4-[3-(4-chloro-3-nitroanilino)-2-cyano-3-oxoprop-1-enyl]phenyl] 4-methyl-3-nitrobenzenesulfonate |
| SMILES | Cc1ccc(S(=O)(=O)Oc2ccc(C=C(C#N)C(=O)Nc3ccc(Cl)c([N+](=O)[O-])c3)cc2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C23H15ClN4O8S/c1-14-2-8-19(12-21(14)27(30)31)37(34,35)36-18-6-3-15(4-7-18)10-16(13-25)23(29)26-17-5-9-20(24)22(11-17)28(32)33/h2-12H,1H3,(H,26,29) |
| InChIKey | BYSDEJCPJPYUAU-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 182.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.91 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|