C14H11BrClNO5S — CID 126072572
[2-bromo-4-[(Z)-hydroxyiminomethyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126072572) has the molecular formula C14H11BrClNO5S and a molecular weight of 420.67 g/mol. Its IUPAC name is [2-bromo-4-[(Z)-hydroxyiminomethyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-4-[(Z)-hydroxyiminomethyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126072572 |
| Molecular Formula | C14H11BrClNO5S |
| Molecular Weight | 420.67 g/mol |
| Exact Mass | 418.92 |
| IUPAC Name | [2-bromo-4-[(Z)-hydroxyiminomethyl]-6-methoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | COc1cc(/C=N\O)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11BrClNO5S/c1-21-13-7-9(8-17-18)6-12(15)14(13)22-23(19,20)11-4-2-10(16)3-5-11/h2-8,18H,1H3/b17-8- |
| InChIKey | KJAAWGIBDFHUIE-IUXPMGMMSA-N |
| XLogP | 3.69 |
| TPSA | 85.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.67 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|