C14H10BrClO6S — CID 134717200
3-bromo-4-(4-chlorophenyl)sulfonyloxy-5-methoxybenzoic acid (PubChem CID 134717200) has the molecular formula C14H10BrClO6S and a molecular weight of 421.65 g/mol. Its IUPAC name is 3-bromo-4-(4-chlorophenyl)sulfonyloxy-5-methoxybenzoic acid.
| Compound Name | 3-bromo-4-(4-chlorophenyl)sulfonyloxy-5-methoxybenzoic acid |
|---|---|
| PubChem CID | 134717200 |
| Molecular Formula | C14H10BrClO6S |
| Molecular Weight | 421.65 g/mol |
| Exact Mass | 419.91 |
| IUPAC Name | 3-bromo-4-(4-chlorophenyl)sulfonyloxy-5-methoxybenzoic acid |
| SMILES | COc1cc(C(=O)O)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H10BrClO6S/c1-21-12-7-8(14(17)18)6-11(15)13(12)22-23(19,20)10-4-2-9(16)3-5-10/h2-7H,1H3,(H,17,18) |
| InChIKey | MWVILMCIJRABNN-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.65 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|