C22H18BrCl2NO4S — CID 126214007
[2-bromo-4-[(5-chloro-2-methylphenyl)iminomethyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate (PubChem CID 126214007) has the molecular formula C22H18BrCl2NO4S and a molecular weight of 543.27 g/mol. Its IUPAC name is [2-bromo-4-[(5-chloro-2-methylphenyl)iminomethyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate.
| Compound Name | [2-bromo-4-[(5-chloro-2-methylphenyl)iminomethyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate |
|---|---|
| PubChem CID | 126214007 |
| Molecular Formula | C22H18BrCl2NO4S |
| Molecular Weight | 543.27 g/mol |
| Exact Mass | 540.95 |
| IUPAC Name | [2-bromo-4-[(5-chloro-2-methylphenyl)iminomethyl]-6-ethoxyphenyl] 4-chlorobenzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2cc(Cl)ccc2C)cc(Br)c1OS(=O)(=O)c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H18BrCl2NO4S/c1-3-29-21-11-15(13-26-20-12-17(25)5-4-14(20)2)10-19(23)22(21)30-31(27,28)18-8-6-16(24)7-9-18/h4-13H,3H2,1-2H3/b26-13+ |
| InChIKey | ABULANNFYDETAP-LGJNPRDNSA-N |
| XLogP | 6.98 |
| TPSA | 64.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.27 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|