C28H24BrNO5S — CID 126217420
[2-bromo-6-ethoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126217420) has the molecular formula C28H24BrNO5S and a molecular weight of 566.47 g/mol. Its IUPAC name is [2-bromo-6-ethoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-bromo-6-ethoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126217420 |
| Molecular Formula | C28H24BrNO5S |
| Molecular Weight | 566.47 g/mol |
| Exact Mass | 565.06 |
| IUPAC Name | [2-bromo-6-ethoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | CCOc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(Br)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C28H24BrNO5S/c1-3-33-27-18-21(17-26(29)28(27)35-36(31,32)25-15-9-20(2)10-16-25)19-30-22-11-13-24(14-12-22)34-23-7-5-4-6-8-23/h4-19H,3H2,1-2H3/b30-19+ |
| InChIKey | NBXNPTKMAHZAKD-NDZAJKAJSA-N |
| XLogP | 7.47 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.47 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|