About [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate
[2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126219352) has the molecular formula C27H22INO5S
and a molecular weight of 599.45 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
Molecular Properties
| Compound Name | [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| PubChem CID | 126219352 |
| Molecular Formula | C27H22INO5S |
| Molecular Weight | 599.45 g/mol |
| Exact Mass | 599.03 |
| IUPAC Name | [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(I)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C27H22INO5S/c1-19-8-14-24(15-9-19)35(30,31)34-27-25(28)16-20(17-26(27)32-2)18-29-21-10-12-23(13-11-21)33-22-6-4-3-5-7-22/h3-18H,1-2H3/b29-18+ |
| InChIKey | OSHOLIUFDGCRFK-RDRPBHBLSA-N |
| XLogP | 6.92 |
| TPSA | 74.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 599.45 |
| LogP ≤ 5 | 6.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate?
The IUPAC name of [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate (CID 126219352) is [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate.
What is the SMILES notation for [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate?
The canonical SMILES for [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate is COc1cc(/C=N/c2ccc(Oc3ccccc3)cc2)cc(I)c1OS(=O)(=O)c1ccc(C)cc1.
What is the InChIKey of [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate?
The InChIKey is OSHOLIUFDGCRFK-RDRPBHBLSA-N. The full InChI is InChI=1S/C27H22INO5S/c1-19-8-14-24(15-9-19)35(30,31)34-27-25(28)16-20(17-26(27)32-2)18-29-21-10-12-23(13-11-21)33-22-6-4-3-5-7-22/h3-18H,1-2H3/b29-18+.
What are the key properties of [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate?
[2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate has a molecular weight of 599.45 g/mol, XLogP of 6.92, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [2-iodo-6-methoxy-4-[(4-phenoxyphenyl)iminomethyl]phenyl] 4-methylbenzenesulfonate is sourced from PubChem (CID 126219352), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).