C30H23IN2O5S2 — CID 126085491
[2-iodo-6-methoxy-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate (PubChem CID 126085491) has the molecular formula C30H23IN2O5S2 and a molecular weight of 682.56 g/mol. Its IUPAC name is [2-iodo-6-methoxy-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate.
| Compound Name | [2-iodo-6-methoxy-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
|---|---|
| PubChem CID | 126085491 |
| Molecular Formula | C30H23IN2O5S2 |
| Molecular Weight | 682.56 g/mol |
| Exact Mass | 682.01 |
| IUPAC Name | [2-iodo-6-methoxy-4-[(E)-(4-oxo-3-phenyl-2-phenylimino-1,3-thiazolidin-5-ylidene)methyl]phenyl] 4-methylbenzenesulfonate |
| SMILES | COc1cc(/C=C2/S/C(=N\c3ccccc3)N(c3ccccc3)C2=O)cc(I)c1OS(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/C30H23IN2O5S2/c1-20-13-15-24(16-14-20)40(35,36)38-28-25(31)17-21(18-26(28)37-2)19-27-29(34)33(23-11-7-4-8-12-23)30(39-27)32-22-9-5-3-6-10-22/h3-19H,1-2H3/b27-19+,32-30- |
| InChIKey | KMVDFXLDZRHTRP-RLEBBJDLSA-N |
| XLogP | 7.18 |
| TPSA | 85.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.56 |
| LogP ≤ 5 | 7.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|